C17H14N6OS2 — CID 3129883
2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 3129883) has the molecular formula C17H14N6OS2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 3129883 |
| Molecular Formula | C17H14N6OS2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | C=CCn1c2ccccc2c2nnc(SCC(=O)Nc3nccs3)nc21 |
| InChI | InChI=1S/C17H14N6OS2/c1-2-8-23-12-6-4-3-5-11(12)14-15(23)20-17(22-21-14)26-10-13(24)19-16-18-7-9-25-16/h2-7,9H,1,8,10H2,(H,18,19,24) |
| InChIKey | RIFDSRDHPJVBAH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_656a(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|