C18H14N4OS2 — CID 17308906
2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-1-thiophen-2-ylethanone (PubChem CID 17308906) has the molecular formula C18H14N4OS2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-1-thiophen-2-ylethanone.
| Compound Name | 2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-1-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 17308906 |
| Molecular Formula | C18H14N4OS2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-1-thiophen-2-ylethanone |
| SMILES | C=CCn1c2ccccc2c2nnc(SCC(=O)c3cccs3)nc21 |
| InChI | InChI=1S/C18H14N4OS2/c1-2-9-22-13-7-4-3-6-12(13)16-17(22)19-18(21-20-16)25-11-14(23)15-8-5-10-24-15/h2-8,10H,1,9,11H2 |
| InChIKey | YJSDWDXBEBTGRT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_656a(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|