C24H24N6O2S — CID 6407728
(2R)-N-(4-acetamidophenyl)-2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanamide (PubChem CID 6407728) has the molecular formula C24H24N6O2S and a molecular weight of 460.56 g/mol. Its IUPAC name is (2R)-N-(4-acetamidophenyl)-2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanamide.
| Compound Name | (2R)-N-(4-acetamidophenyl)-2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 6407728 |
| Molecular Formula | C24H24N6O2S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | (2R)-N-(4-acetamidophenyl)-2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanamide |
| SMILES | C=CCn1c2ccccc2c2nnc(S[C@H](CC)C(=O)Nc3ccc(NC(C)=O)cc3)nc21 |
| InChI | InChI=1S/C24H24N6O2S/c1-4-14-30-19-9-7-6-8-18(19)21-22(30)27-24(29-28-21)33-20(5-2)23(32)26-17-12-10-16(11-13-17)25-15(3)31/h4,6-13,20H,1,5,14H2,2-3H3,(H,25,31)(H,26,32)/t20-/m1/s1 |
| InChIKey | FGWKVPVVMQEYOK-HXUWFJFHSA-N |
| XLogP | 4.63 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|