C22H18N6O2S — CID 118986348
N-[3-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanylmethyl]-1,2-benzoxazol-5-yl]acetamide (PubChem CID 118986348) has the molecular formula C22H18N6O2S and a molecular weight of 430.49 g/mol. Its IUPAC name is N-[3-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanylmethyl]-1,2-benzoxazol-5-yl]acetamide.
| Compound Name | N-[3-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanylmethyl]-1,2-benzoxazol-5-yl]acetamide |
|---|---|
| PubChem CID | 118986348 |
| Molecular Formula | C22H18N6O2S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | N-[3-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanylmethyl]-1,2-benzoxazol-5-yl]acetamide |
| SMILES | C=CCn1c2ccccc2c2nnc(SCc3noc4ccc(NC(C)=O)cc34)nc21 |
| InChI | InChI=1S/C22H18N6O2S/c1-3-10-28-18-7-5-4-6-15(18)20-21(28)24-22(26-25-20)31-12-17-16-11-14(23-13(2)29)8-9-19(16)30-27-17/h3-9,11H,1,10,12H2,2H3,(H,23,29) |
| InChIKey | IQJZUWJRDFZMBS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 98.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|