C23H20N6O2S2 — CID 6413606
N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetamide (PubChem CID 6413606) has the molecular formula C23H20N6O2S2 and a molecular weight of 476.59 g/mol. Its IUPAC name is N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 6413606 |
| Molecular Formula | C23H20N6O2S2 |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c2ccccc2c2nnc(SCC(=O)Nc3nc4ccc(OCC)cc4s3)nc21 |
| InChI | InChI=1S/C23H20N6O2S2/c1-3-11-29-17-8-6-5-7-15(17)20-21(29)26-23(28-27-20)32-13-19(30)25-22-24-16-10-9-14(31-4-2)12-18(16)33-22/h3,5-10,12H,1,4,11,13H2,2H3,(H,24,25,30) |
| InChIKey | PTNSLUPPSRASAQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_656a(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|