C27H29N5O3S2 — CID 5289929
ethyl 2-[2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 5289929) has the molecular formula C27H29N5O3S2 and a molecular weight of 535.70 g/mol. Its IUPAC name is ethyl 2-[2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 5289929 |
| Molecular Formula | C27H29N5O3S2 |
| Molecular Weight | 535.70 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | ethyl 2-[2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | C=CCn1c2ccccc2c2nnc(SC(CC)C(=O)Nc3sc4c(c3C(=O)OCC)CCCC4)nc21 |
| InChI | InChI=1S/C27H29N5O3S2/c1-4-15-32-18-13-9-7-11-16(18)22-23(32)28-27(31-30-22)37-19(5-2)24(33)29-25-21(26(34)35-6-3)17-12-8-10-14-20(17)36-25/h4,7,9,11,13,19H,1,5-6,8,10,12,14-15H2,2-3H3,(H,29,33) |
| InChIKey | QSDOVWRZFORXQZ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.70 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|