C24H25N7OS2 — CID 23857931
N-(3-cyano-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-2-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanamide (PubChem CID 23857931) has the molecular formula C24H25N7OS2 and a molecular weight of 491.65 g/mol. Its IUPAC name is N-(3-cyano-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-2-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanamide.
| Compound Name | N-(3-cyano-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-2-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 23857931 |
| Molecular Formula | C24H25N7OS2 |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | N-(3-cyano-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-2-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanamide |
| SMILES | CCC(Sc1nnc2c3ccccc3n(CC)c2n1)C(=O)Nc1sc2c(c1C#N)CCN(C)C2 |
| InChI | InChI=1S/C24H25N7OS2/c1-4-18(22(32)27-23-16(12-25)14-10-11-30(3)13-19(14)33-23)34-24-26-21-20(28-29-24)15-8-6-7-9-17(15)31(21)5-2/h6-9,18H,4-5,10-11,13H2,1-3H3,(H,27,32) |
| InChIKey | TVHVYSHGDFCKMX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 99.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |