C25H25N7OS2 — CID 6412619
2-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[5-(4-methylphenyl)-6H-1,3,4-thiadiazin-2-yl]butanamide (PubChem CID 6412619) has the molecular formula C25H25N7OS2 and a molecular weight of 503.66 g/mol. Its IUPAC name is 2-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[5-(4-methylphenyl)-6H-1,3,4-thiadiazin-2-yl]butanamide.
| Compound Name | 2-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[5-(4-methylphenyl)-6H-1,3,4-thiadiazin-2-yl]butanamide |
|---|---|
| PubChem CID | 6412619 |
| Molecular Formula | C25H25N7OS2 |
| Molecular Weight | 503.66 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 2-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[5-(4-methylphenyl)-6H-1,3,4-thiadiazin-2-yl]butanamide |
| SMILES | CCC(Sc1nnc2c3ccccc3n(CC)c2n1)C(=O)NC1=NN=C(c2ccc(C)cc2)CS1 |
| InChI | InChI=1S/C25H25N7OS2/c1-4-20(23(33)27-24-30-28-18(14-34-24)16-12-10-15(3)11-13-16)35-25-26-22-21(29-31-25)17-8-6-7-9-19(17)32(22)5-2/h6-13,20H,4-5,14H2,1-3H3,(H,27,30,33) |
| InChIKey | WWHUPVQYWLFGDS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.66 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |