C26H29N5O3S2 — CID 5287137
ethyl 2-[2-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 5287137) has the molecular formula C26H29N5O3S2 and a molecular weight of 523.68 g/mol. Its IUPAC name is ethyl 2-[2-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 5287137 |
| Molecular Formula | C26H29N5O3S2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | ethyl 2-[2-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(CC)Sc2nnc3c4ccccc4n(CC)c3n2)sc2c1CCCC2 |
| InChI | InChI=1S/C26H29N5O3S2/c1-4-18(23(32)28-24-20(25(33)34-6-3)16-12-8-10-14-19(16)35-24)36-26-27-22-21(29-30-26)15-11-7-9-13-17(15)31(22)5-2/h7,9,11,13,18H,4-6,8,10,12,14H2,1-3H3,(H,28,32) |
| InChIKey | RHTWAQHKCUUAGW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |