C22H20N6OS2 — CID 6407729
(2S)-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)butanamide (PubChem CID 6407729) has the molecular formula C22H20N6OS2 and a molecular weight of 448.58 g/mol. Its IUPAC name is (2S)-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)butanamide.
| Compound Name | (2S)-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)butanamide |
|---|---|
| PubChem CID | 6407729 |
| Molecular Formula | C22H20N6OS2 |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | (2S)-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)butanamide |
| SMILES | CC[C@H](Sc1nnc2c(n1)[nH]c1ccccc12)C(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C22H20N6OS2/c1-2-16(20(29)26-21-14(11-23)12-7-4-6-10-17(12)30-21)31-22-25-19-18(27-28-22)13-8-3-5-9-15(13)24-19/h3,5,8-9,16H,2,4,6-7,10H2,1H3,(H,26,29)(H,24,25,28)/t16-/m0/s1 |
| InChIKey | PQFLATZTAZEPFL-INIZCTEOSA-N |
| XLogP | 4.83 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |