C20H18N6O2S — CID 23942416
2-[2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)butanoylamino]benzamide (PubChem CID 23942416) has the molecular formula C20H18N6O2S and a molecular weight of 406.47 g/mol. Its IUPAC name is 2-[2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)butanoylamino]benzamide.
| Compound Name | 2-[2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)butanoylamino]benzamide |
|---|---|
| PubChem CID | 23942416 |
| Molecular Formula | C20H18N6O2S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 2-[2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)butanoylamino]benzamide |
| SMILES | CCC(Sc1nnc2c(n1)[nH]c1ccccc12)C(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C20H18N6O2S/c1-2-15(19(28)23-14-10-6-4-8-12(14)17(21)27)29-20-24-18-16(25-26-20)11-7-3-5-9-13(11)22-18/h3-10,15H,2H2,1H3,(H2,21,27)(H,23,28)(H,22,24,26) |
| InChIKey | HORYEXWIRDKQJF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |