C18H16N6OS — CID 23914439
N-pyridin-2-yl-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)butanamide (PubChem CID 23914439) has the molecular formula C18H16N6OS and a molecular weight of 364.43 g/mol. Its IUPAC name is N-pyridin-2-yl-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)butanamide.
| Compound Name | N-pyridin-2-yl-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)butanamide |
|---|---|
| PubChem CID | 23914439 |
| Molecular Formula | C18H16N6OS |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-pyridin-2-yl-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)butanamide |
| SMILES | CCC(Sc1nnc2c(n1)[nH]c1ccccc12)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C18H16N6OS/c1-2-13(17(25)21-14-9-5-6-10-19-14)26-18-22-16-15(23-24-18)11-7-3-4-8-12(11)20-16/h3-10,13H,2H2,1H3,(H,19,21,25)(H,20,22,24) |
| InChIKey | RNODITDYKQLXGH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |