C23H23N5O3S2 — CID 17271537
ethyl 2-[2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 17271537) has the molecular formula C23H23N5O3S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is ethyl 2-[2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 17271537 |
| Molecular Formula | C23H23N5O3S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | ethyl 2-[2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C)Sc2nnc3c(n2)[nH]c2ccccc23)sc2c1CCCC2 |
| InChI | InChI=1S/C23H23N5O3S2/c1-3-31-22(30)17-14-9-5-7-11-16(14)33-21(17)26-20(29)12(2)32-23-25-19-18(27-28-23)13-8-4-6-10-15(13)24-19/h4,6,8,10,12H,3,5,7,9,11H2,1-2H3,(H,26,29)(H,24,25,28) |
| InChIKey | LSZKFKJNIULUMS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |