C24H25N5O3S2 — CID 23889162
ethyl 6-methyl-2-[3-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 23889162) has the molecular formula C24H25N5O3S2 and a molecular weight of 495.63 g/mol. Its IUPAC name is ethyl 6-methyl-2-[3-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 6-methyl-2-[3-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 23889162 |
| Molecular Formula | C24H25N5O3S2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | ethyl 6-methyl-2-[3-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCSc2nnc3c(n2)[nH]c2ccccc23)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C24H25N5O3S2/c1-3-32-23(31)19-15-9-8-13(2)12-17(15)34-22(19)26-18(30)10-11-33-24-27-21-20(28-29-24)14-6-4-5-7-16(14)25-21/h4-7,13H,3,8-12H2,1-2H3,(H,26,30)(H,25,27,29) |
| InChIKey | FGZOIGVLYHCYBG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |