C26H27N5O4S2 — CID 136637818
ethyl 2-[2-[[1-(2-methylphenyl)-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 136637818) has the molecular formula C26H27N5O4S2 and a molecular weight of 537.67 g/mol. Its IUPAC name is ethyl 2-[2-[[1-(2-methylphenyl)-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[[1-(2-methylphenyl)-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 136637818 |
| Molecular Formula | C26H27N5O4S2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | ethyl 2-[2-[[1-(2-methylphenyl)-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C)Sc2nc3c(cnn3-c3ccccc3C)c(=O)[nH]2)sc2c1CCCC2 |
| InChI | InChI=1S/C26H27N5O4S2/c1-4-35-25(34)20-16-10-6-8-12-19(16)37-24(20)29-22(32)15(3)36-26-28-21-17(23(33)30-26)13-27-31(21)18-11-7-5-9-14(18)2/h5,7,9,11,13,15H,4,6,8,10,12H2,1-3H3,(H,29,32)(H,28,30,33) |
| InChIKey | QPSSKOCCGPBVRG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |