C15H12N2O2S3 — CID 130188489
2-(2-oxo-2-thiophen-2-ylethyl)sulfanyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 130188489) has the molecular formula C15H12N2O2S3 and a molecular weight of 348.47 g/mol. Its IUPAC name is 2-(2-oxo-2-thiophen-2-ylethyl)sulfanyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(2-oxo-2-thiophen-2-ylethyl)sulfanyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 130188489 |
| Molecular Formula | C15H12N2O2S3 |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 2-(2-oxo-2-thiophen-2-ylethyl)sulfanyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCC(=O)c2cccs2)nc2sccc2c1=O |
| InChI | InChI=1S/C15H12N2O2S3/c1-2-6-17-14(19)10-5-8-21-13(10)16-15(17)22-9-11(18)12-4-3-7-20-12/h2-5,7-8H,1,6,9H2 |
| InChIKey | QKRPYWOWQHCBFA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|