C17H15FN2O2S2 — CID 112784883
2-[2-(2-fluorophenoxy)ethylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 112784883) has the molecular formula C17H15FN2O2S2 and a molecular weight of 362.45 g/mol. Its IUPAC name is 2-[2-(2-fluorophenoxy)ethylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[2-(2-fluorophenoxy)ethylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 112784883 |
| Molecular Formula | C17H15FN2O2S2 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 2-[2-(2-fluorophenoxy)ethylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCCOc2ccccc2F)nc2sccc2c1=O |
| InChI | InChI=1S/C17H15FN2O2S2/c1-2-8-20-16(21)12-7-10-23-15(12)19-17(20)24-11-9-22-14-6-4-3-5-13(14)18/h2-7,10H,1,8-9,11H2 |
| InChIKey | NXACRKDIMOAQAR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|