C17H11FN4OS2 — CID 133425874
2-(6-fluoroquinazolin-4-yl)sulfanyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 133425874) has the molecular formula C17H11FN4OS2 and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-(6-fluoroquinazolin-4-yl)sulfanyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(6-fluoroquinazolin-4-yl)sulfanyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 133425874 |
| Molecular Formula | C17H11FN4OS2 |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 2-(6-fluoroquinazolin-4-yl)sulfanyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(Sc2ncnc3ccc(F)cc23)nc2sccc2c1=O |
| InChI | InChI=1S/C17H11FN4OS2/c1-2-6-22-16(23)11-5-7-24-15(11)21-17(22)25-14-12-8-10(18)3-4-13(12)19-9-20-14/h2-5,7-9H,1,6H2 |
| InChIKey | LYJJWWLNSCXYCS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|