C19H14FN3O2S2 — CID 25484945
2-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 25484945) has the molecular formula C19H14FN3O2S2 and a molecular weight of 399.47 g/mol. Its IUPAC name is 2-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 25484945 |
| Molecular Formula | C19H14FN3O2S2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 2-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCc2coc(-c3ccc(F)cc3)n2)nc2sccc2c1=O |
| InChI | InChI=1S/C19H14FN3O2S2/c1-2-8-23-18(24)15-7-9-26-17(15)22-19(23)27-11-14-10-25-16(21-14)12-3-5-13(20)6-4-12/h2-7,9-10H,1,8,11H2 |
| InChIKey | IBBJDYAVFQBAOS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|