C16H15N3O3S2 — CID 7201820
N-(furan-2-ylmethyl)-2-(4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide (PubChem CID 7201820) has the molecular formula C16H15N3O3S2 and a molecular weight of 361.45 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 7201820 |
| Molecular Formula | C16H15N3O3S2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)NCc2ccco2)nc2sccc2c1=O |
| InChI | InChI=1S/C16H15N3O3S2/c1-2-6-19-15(21)12-5-8-23-14(12)18-16(19)24-10-13(20)17-9-11-4-3-7-22-11/h2-5,7-8H,1,6,9-10H2,(H,17,20) |
| InChIKey | KPPZPBCZFBNTQR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|