C17H13N3O3S2 — CID 17399309
2-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 17399309) has the molecular formula C17H13N3O3S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 17399309 |
| Molecular Formula | C17H13N3O3S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 2-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCc2cc(-c3ccco3)on2)nc2sccc2c1=O |
| InChI | InChI=1S/C17H13N3O3S2/c1-2-6-20-16(21)12-5-8-24-15(12)18-17(20)25-10-11-9-14(23-19-11)13-4-3-7-22-13/h2-5,7-9H,1,6,10H2 |
| InChIKey | UOZBZOXIGBOJCQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|