C18H14N4O2S2 — CID 51140921
2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 51140921) has the molecular formula C18H14N4O2S2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 51140921 |
| Molecular Formula | C18H14N4O2S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCc2nnc(-c3ccccc3)o2)nc2sccc2c1=O |
| InChI | InChI=1S/C18H14N4O2S2/c1-2-9-22-17(23)13-8-10-25-16(13)19-18(22)26-11-14-20-21-15(24-14)12-6-4-3-5-7-12/h2-8,10H,1,9,11H2 |
| InChIKey | LKFSADPRHFSMTJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|