C19H17N7OS2 — CID 55384280
2-[(4-amino-6-anilino-1,3,5-triazin-2-yl)methylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 55384280) has the molecular formula C19H17N7OS2 and a molecular weight of 423.53 g/mol. Its IUPAC name is 2-[(4-amino-6-anilino-1,3,5-triazin-2-yl)methylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(4-amino-6-anilino-1,3,5-triazin-2-yl)methylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 55384280 |
| Molecular Formula | C19H17N7OS2 |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 2-[(4-amino-6-anilino-1,3,5-triazin-2-yl)methylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCc2nc(N)nc(Nc3ccccc3)n2)nc2sccc2c1=O |
| InChI | InChI=1S/C19H17N7OS2/c1-2-9-26-16(27)13-8-10-28-15(13)24-19(26)29-11-14-22-17(20)25-18(23-14)21-12-6-4-3-5-7-12/h2-8,10H,1,9,11H2,(H3,20,21,22,23,25) |
| InChIKey | KDHKMUDQVSBWBU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|