C23H22N8O2S — CID 41213916
6-[[5-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 41213916) has the molecular formula C23H22N8O2S and a molecular weight of 474.55 g/mol. Its IUPAC name is 6-[[5-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[5-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 41213916 |
| Molecular Formula | C23H22N8O2S |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 6-[[5-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCn1c(SCc2nc(N)nc(Nc3ccccc3)n2)nnc1[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C23H22N8O2S/c1-2-12-31-20(18-13-32-16-10-6-7-11-17(16)33-18)29-30-23(31)34-14-19-26-21(24)28-22(27-19)25-15-8-4-3-5-9-15/h2-11,18H,1,12-14H2,(H3,24,25,26,27,28)/t18-/m1/s1 |
| InChIKey | BIFPYQXITPKAHS-GOSISDBHSA-N |
| XLogP | 3.78 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|