C21H20N8S — CID 7593851
2-N-phenyl-6-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 7593851) has the molecular formula C21H20N8S and a molecular weight of 416.51 g/mol. Its IUPAC name is 2-N-phenyl-6-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-phenyl-6-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 7593851 |
| Molecular Formula | C21H20N8S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2-N-phenyl-6-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCn1c(SCc2nc(N)nc(Nc3ccccc3)n2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C21H20N8S/c1-2-13-29-18(15-9-5-3-6-10-15)27-28-21(29)30-14-17-24-19(22)26-20(25-17)23-16-11-7-4-8-12-16/h2-12H,1,13-14H2,(H3,22,23,24,25,26) |
| InChIKey | UKCKEVWMQLCKSQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|