C23H24N8S — CID 112782139
2-N-(2-methylphenyl)-6-[[5-(3-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 112782139) has the molecular formula C23H24N8S and a molecular weight of 444.57 g/mol. Its IUPAC name is 2-N-(2-methylphenyl)-6-[[5-(3-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2-methylphenyl)-6-[[5-(3-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 112782139 |
| Molecular Formula | C23H24N8S |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 2-N-(2-methylphenyl)-6-[[5-(3-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCn1c(SCc2nc(N)nc(Nc3ccccc3C)n2)nnc1-c1cccc(C)c1 |
| InChI | InChI=1S/C23H24N8S/c1-4-12-31-20(17-10-7-8-15(2)13-17)29-30-23(31)32-14-19-26-21(24)28-22(27-19)25-18-11-6-5-9-16(18)3/h4-11,13H,1,12,14H2,2-3H3,(H3,24,25,26,27,28) |
| InChIKey | QGNXZTDAQNAQNR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|