C19H18N8S — CID 7891383
2-N-(2-methylphenyl)-6-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 7891383) has the molecular formula C19H18N8S and a molecular weight of 390.48 g/mol. Its IUPAC name is 2-N-(2-methylphenyl)-6-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2-methylphenyl)-6-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 7891383 |
| Molecular Formula | C19H18N8S |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 2-N-(2-methylphenyl)-6-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccccc1Nc1nc(N)nc(CSc2n[nH]c(-c3ccccc3)n2)n1 |
| InChI | InChI=1S/C19H18N8S/c1-12-7-5-6-10-14(12)21-18-23-15(22-17(20)25-18)11-28-19-24-16(26-27-19)13-8-3-2-4-9-13/h2-10H,11H2,1H3,(H,24,26,27)(H3,20,21,22,23,25) |
| InChIKey | JGNGDQCGPSIILP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |