C21H21N7OS — CID 55374787
6-[[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 55374787) has the molecular formula C21H21N7OS and a molecular weight of 419.51 g/mol. Its IUPAC name is 6-[[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 55374787 |
| Molecular Formula | C21H21N7OS |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 6-[[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cc(C)cc(-c2nnc(SCc3nc(N)nc(Nc4ccccc4C)n3)o2)c1 |
| InChI | InChI=1S/C21H21N7OS/c1-12-8-13(2)10-15(9-12)18-27-28-21(29-18)30-11-17-24-19(22)26-20(25-17)23-16-7-5-4-6-14(16)3/h4-10H,11H2,1-3H3,(H3,22,23,24,25,26) |
| InChIKey | STOOGAZUPMZWSC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |