C21H19N7O3S — CID 2565583
6-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-N-(2-ethylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 2565583) has the molecular formula C21H19N7O3S and a molecular weight of 449.50 g/mol. Its IUPAC name is 6-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-N-(2-ethylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-N-(2-ethylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 2565583 |
| Molecular Formula | C21H19N7O3S |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 6-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-N-(2-ethylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCc1ccccc1Nc1nc(N)nc(CSc2nnc(-c3ccc4c(c3)OCO4)o2)n1 |
| InChI | InChI=1S/C21H19N7O3S/c1-2-12-5-3-4-6-14(12)23-20-25-17(24-19(22)26-20)10-32-21-28-27-18(31-21)13-7-8-15-16(9-13)30-11-29-15/h3-9H,2,10-11H2,1H3,(H3,22,23,24,25,26) |
| InChIKey | ISOPKRJDNBYMMP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 134.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |