C28H36N11+ — CID 25375679
6-[[1-[[4-amino-6-(2-ethylanilino)-1,3,5-triazin-2-yl]methyl]pyrrolidin-1-ium-1-yl]methyl]-2-N-(2-ethylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 25375679) has the molecular formula C28H36N11+ and a molecular weight of 526.67 g/mol. Its IUPAC name is 6-[[1-[[4-amino-6-(2-ethylanilino)-1,3,5-triazin-2-yl]methyl]pyrrolidin-1-ium-1-yl]methyl]-2-N-(2-ethylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[1-[[4-amino-6-(2-ethylanilino)-1,3,5-triazin-2-yl]methyl]pyrrolidin-1-ium-1-yl]methyl]-2-N-(2-ethylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 25375679 |
| Molecular Formula | C28H36N11+ |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | 6-[[1-[[4-amino-6-(2-ethylanilino)-1,3,5-triazin-2-yl]methyl]pyrrolidin-1-ium-1-yl]methyl]-2-N-(2-ethylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCc1ccccc1Nc1nc(N)nc(C[N+]2(Cc3nc(N)nc(Nc4ccccc4CC)n3)CCCC2)n1 |
| InChI | InChI=1S/C28H36N11/c1-3-19-11-5-7-13-21(19)31-27-35-23(33-25(29)37-27)17-39(15-9-10-16-39)18-24-34-26(30)38-28(36-24)32-22-14-8-6-12-20(22)4-2/h5-8,11-14H,3-4,9-10,15-18H2,1-2H3,(H3,29,31,33,35,37)(H3,30,32,34,36,38)/q+1 |
| InChIKey | BFCRWXUHFRUTAV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 153.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|