C18H16N2O3S — CID 2572662
2-(1,3-benzodioxol-5-yl)-5-(3-phenylpropylsulfanyl)-1,3,4-oxadiazole (PubChem CID 2572662) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-5-(3-phenylpropylsulfanyl)-1,3,4-oxadiazole.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-5-(3-phenylpropylsulfanyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 2572662 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-5-(3-phenylpropylsulfanyl)-1,3,4-oxadiazole |
| SMILES | c1ccc(CCCSc2nnc(-c3ccc4c(c3)OCO4)o2)cc1 |
| InChI | InChI=1S/C18H16N2O3S/c1-2-5-13(6-3-1)7-4-10-24-18-20-19-17(23-18)14-8-9-15-16(11-14)22-12-21-15/h1-3,5-6,8-9,11H,4,7,10,12H2 |
| InChIKey | UQQNTEHXHUJTPJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|