C19H20N8OS2 — CID 46531172
6-[[5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-N-(2-ethylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 46531172) has the molecular formula C19H20N8OS2 and a molecular weight of 440.56 g/mol. Its IUPAC name is 6-[[5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-N-(2-ethylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-N-(2-ethylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 46531172 |
| Molecular Formula | C19H20N8OS2 |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 6-[[5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-N-(2-ethylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCc1ccccc1Nc1nc(N)nc(CSc2nnc(-c3sc(C)nc3C)o2)n1 |
| InChI | InChI=1S/C19H20N8OS2/c1-4-12-7-5-6-8-13(12)22-18-24-14(23-17(20)25-18)9-29-19-27-26-16(28-19)15-10(2)21-11(3)30-15/h5-8H,4,9H2,1-3H3,(H3,20,22,23,24,25) |
| InChIKey | ACSUUPSUXSHHID-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 128.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |