C18H23N8OS+ — CID 8849942
2-N-(2-methylphenyl)-6-[[5-(pyrrolidin-1-ium-1-ylmethyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 8849942) has the molecular formula C18H23N8OS+ and a molecular weight of 399.50 g/mol. Its IUPAC name is 2-N-(2-methylphenyl)-6-[[5-(pyrrolidin-1-ium-1-ylmethyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2-methylphenyl)-6-[[5-(pyrrolidin-1-ium-1-ylmethyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 8849942 |
| Molecular Formula | C18H23N8OS+ |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-N-(2-methylphenyl)-6-[[5-(pyrrolidin-1-ium-1-ylmethyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccccc1Nc1nc(N)nc(CSc2nnc(C[NH+]3CCCC3)o2)n1 |
| InChI | InChI=1S/C18H22N8OS/c1-12-6-2-3-7-13(12)20-17-22-14(21-16(19)23-17)11-28-18-25-24-15(27-18)10-26-8-4-5-9-26/h2-3,6-7H,4-5,8-11H2,1H3,(H3,19,20,21,22,23)/p+1 |
| InChIKey | LPLQYVLLKCPZTG-UHFFFAOYSA-O |
| XLogP | 1.36 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |