C17H25N6O+ — CID 8686821
6-[[(2S,6R)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 8686821) has the molecular formula C17H25N6O+ and a molecular weight of 329.43 g/mol. Its IUPAC name is 6-[[(2S,6R)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[(2S,6R)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 8686821 |
| Molecular Formula | C17H25N6O+ |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 6-[[(2S,6R)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccccc1Nc1nc(N)nc(C[NH+]2C[C@@H](C)O[C@@H](C)C2)n1 |
| InChI | InChI=1S/C17H24N6O/c1-11-6-4-5-7-14(11)19-17-21-15(20-16(18)22-17)10-23-8-12(2)24-13(3)9-23/h4-7,12-13H,8-10H2,1-3H3,(H3,18,19,20,21,22)/p+1/t12-,13+ |
| InChIKey | RGONASRXTBFAOE-BETUJISGSA-O |
| XLogP | 0.70 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |