C20H21N9S — CID 2317959
6-[[4-amino-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 2317959) has the molecular formula C20H21N9S and a molecular weight of 419.52 g/mol. Its IUPAC name is 6-[[4-amino-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[4-amino-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 2317959 |
| Molecular Formula | C20H21N9S |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 6-[[4-amino-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(-c2nnc(SCc3nc(N)nc(Nc4ccccc4C)n3)n2N)cc1 |
| InChI | InChI=1S/C20H21N9S/c1-12-7-9-14(10-8-12)17-27-28-20(29(17)22)30-11-16-24-18(21)26-19(25-16)23-15-6-4-3-5-13(15)2/h3-10H,11,22H2,1-2H3,(H3,21,23,24,25,26) |
| InChIKey | SSABXTIUMOAVSF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |