C28H25N9OS — CID 4682357
1-[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methylsulfanyl]-4-[(4-methylphenyl)methyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 4682357) has the molecular formula C28H25N9OS and a molecular weight of 535.64 g/mol. Its IUPAC name is 1-[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methylsulfanyl]-4-[(4-methylphenyl)methyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 1-[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methylsulfanyl]-4-[(4-methylphenyl)methyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 4682357 |
| Molecular Formula | C28H25N9OS |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | 1-[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methylsulfanyl]-4-[(4-methylphenyl)methyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | Cc1ccc(Cn2c(=O)c3ccccc3n3c(SCc4nc(N)nc(Nc5ccccc5C)n4)nnc23)cc1 |
| InChI | InChI=1S/C28H25N9OS/c1-17-11-13-19(14-12-17)15-36-24(38)20-8-4-6-10-22(20)37-27(36)34-35-28(37)39-16-23-31-25(29)33-26(32-23)30-21-9-5-3-7-18(21)2/h3-14H,15-16H2,1-2H3,(H3,29,30,31,32,33) |
| InChIKey | ZPNQOHNMILVYGU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 128.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |