C18H22N8OS2 — CID 41083750
2-N-(2-methylphenyl)-6-[[5-[[(2R)-oxolan-2-yl]methylamino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 41083750) has the molecular formula C18H22N8OS2 and a molecular weight of 430.56 g/mol. Its IUPAC name is 2-N-(2-methylphenyl)-6-[[5-[[(2R)-oxolan-2-yl]methylamino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2-methylphenyl)-6-[[5-[[(2R)-oxolan-2-yl]methylamino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 41083750 |
| Molecular Formula | C18H22N8OS2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 2-N-(2-methylphenyl)-6-[[5-[[(2R)-oxolan-2-yl]methylamino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccccc1Nc1nc(N)nc(CSc2nnc(NC[C@H]3CCCO3)s2)n1 |
| InChI | InChI=1S/C18H22N8OS2/c1-11-5-2-3-7-13(11)21-16-23-14(22-15(19)24-16)10-28-18-26-25-17(29-18)20-9-12-6-4-8-27-12/h2-3,5,7,12H,4,6,8-10H2,1H3,(H,20,25)(H3,19,21,22,23,24)/t12-/m1/s1 |
| InChIKey | JNQQQNQDNPLHKR-GFCCVEGCSA-N |
| XLogP | 3.24 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |