C18H14FN5OS2 — CID 24685624
4-[[5-[(2-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]thieno[2,3-d]pyrimidine (PubChem CID 24685624) has the molecular formula C18H14FN5OS2 and a molecular weight of 399.48 g/mol. Its IUPAC name is 4-[[5-[(2-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]thieno[2,3-d]pyrimidine.
| Compound Name | 4-[[5-[(2-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 24685624 |
| Molecular Formula | C18H14FN5OS2 |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 4-[[5-[(2-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]thieno[2,3-d]pyrimidine |
| SMILES | C=CCn1c(COc2ccccc2F)nnc1Sc1ncnc2sccc12 |
| InChI | InChI=1S/C18H14FN5OS2/c1-2-8-24-15(10-25-14-6-4-3-5-13(14)19)22-23-18(24)27-17-12-7-9-26-16(12)20-11-21-17/h2-7,9,11H,1,8,10H2 |
| InChIKey | XMFVCDNWKHNAEM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|