C18H20FN5O3S — CID 55856462
3-[3-[[5-[(2-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione (PubChem CID 55856462) has the molecular formula C18H20FN5O3S and a molecular weight of 405.46 g/mol. Its IUPAC name is 3-[3-[[5-[(2-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione.
| Compound Name | 3-[3-[[5-[(2-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55856462 |
| Molecular Formula | C18H20FN5O3S |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 3-[3-[[5-[(2-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione |
| SMILES | C=CCn1c(COc2ccccc2F)nnc1SCCCN1C(=O)CNC1=O |
| InChI | InChI=1S/C18H20FN5O3S/c1-2-8-23-15(12-27-14-7-4-3-6-13(14)19)21-22-18(23)28-10-5-9-24-16(25)11-20-17(24)26/h2-4,6-7H,1,5,8-12H2,(H,20,26) |
| InChIKey | FKEUHNJUDYSOSA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|