C19H17BrFN3OS — CID 52889151
3-[(3-bromophenyl)methylsulfanyl]-5-[(2-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 52889151) has the molecular formula C19H17BrFN3OS and a molecular weight of 434.33 g/mol. Its IUPAC name is 3-[(3-bromophenyl)methylsulfanyl]-5-[(2-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[(3-bromophenyl)methylsulfanyl]-5-[(2-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 52889151 |
| Molecular Formula | C19H17BrFN3OS |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | 3-[(3-bromophenyl)methylsulfanyl]-5-[(2-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(COc2ccccc2F)nnc1SCc1cccc(Br)c1 |
| InChI | InChI=1S/C19H17BrFN3OS/c1-2-10-24-18(12-25-17-9-4-3-8-16(17)21)22-23-19(24)26-13-14-6-5-7-15(20)11-14/h2-9,11H,1,10,12-13H2 |
| InChIKey | DUXSKGBIEWIDTJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|