C20H20FN3O2S — CID 126333190
3-[(4-fluorophenyl)methylsulfanyl]-5-[(2-methoxyphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 126333190) has the molecular formula C20H20FN3O2S and a molecular weight of 385.46 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methylsulfanyl]-5-[(2-methoxyphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[(4-fluorophenyl)methylsulfanyl]-5-[(2-methoxyphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 126333190 |
| Molecular Formula | C20H20FN3O2S |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 3-[(4-fluorophenyl)methylsulfanyl]-5-[(2-methoxyphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(COc2ccccc2OC)nnc1SCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H20FN3O2S/c1-3-12-24-19(13-26-18-7-5-4-6-17(18)25-2)22-23-20(24)27-14-15-8-10-16(21)11-9-15/h3-11H,1,12-14H2,2H3 |
| InChIKey | HBRUTLRWYAMNOR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|