C22H20FN5OS — CID 37098613
3-[(2-fluorophenoxy)methyl]-4-prop-2-enyl-5-[(4-pyrazol-1-ylphenyl)methylsulfanyl]-1,2,4-triazole (PubChem CID 37098613) has the molecular formula C22H20FN5OS and a molecular weight of 421.50 g/mol. Its IUPAC name is 3-[(2-fluorophenoxy)methyl]-4-prop-2-enyl-5-[(4-pyrazol-1-ylphenyl)methylsulfanyl]-1,2,4-triazole.
| Compound Name | 3-[(2-fluorophenoxy)methyl]-4-prop-2-enyl-5-[(4-pyrazol-1-ylphenyl)methylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 37098613 |
| Molecular Formula | C22H20FN5OS |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 3-[(2-fluorophenoxy)methyl]-4-prop-2-enyl-5-[(4-pyrazol-1-ylphenyl)methylsulfanyl]-1,2,4-triazole |
| SMILES | C=CCn1c(COc2ccccc2F)nnc1SCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C22H20FN5OS/c1-2-13-27-21(15-29-20-7-4-3-6-19(20)23)25-26-22(27)30-16-17-8-10-18(11-9-17)28-14-5-12-24-28/h2-12,14H,1,13,15-16H2 |
| InChIKey | XRFJFWXYIJNKLR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|