C21H22FN3OS — CID 17304102
3-[(2,5-dimethylphenoxy)methyl]-5-[(3-fluorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 17304102) has the molecular formula C21H22FN3OS and a molecular weight of 383.49 g/mol. Its IUPAC name is 3-[(2,5-dimethylphenoxy)methyl]-5-[(3-fluorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[(2,5-dimethylphenoxy)methyl]-5-[(3-fluorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 17304102 |
| Molecular Formula | C21H22FN3OS |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 3-[(2,5-dimethylphenoxy)methyl]-5-[(3-fluorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(COc2cc(C)ccc2C)nnc1SCc1cccc(F)c1 |
| InChI | InChI=1S/C21H22FN3OS/c1-4-10-25-20(13-26-19-11-15(2)8-9-16(19)3)23-24-21(25)27-14-17-6-5-7-18(22)12-17/h4-9,11-12H,1,10,13-14H2,2-3H3 |
| InChIKey | MHAZIIFWAAXELI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|