C22H25N3OS — CID 21165752
3-[(3,4-dimethylphenoxy)methyl]-5-[(3-methylphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 21165752) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is 3-[(3,4-dimethylphenoxy)methyl]-5-[(3-methylphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[(3,4-dimethylphenoxy)methyl]-5-[(3-methylphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 21165752 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 3-[(3,4-dimethylphenoxy)methyl]-5-[(3-methylphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(COc2ccc(C)c(C)c2)nnc1SCc1cccc(C)c1 |
| InChI | InChI=1S/C22H25N3OS/c1-5-11-25-21(14-26-20-10-9-17(3)18(4)13-20)23-24-22(25)27-15-19-8-6-7-16(2)12-19/h5-10,12-13H,1,11,14-15H2,2-4H3 |
| InChIKey | RVBCSWMVFWXRSW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|