C16H20N4OS — CID 142257255
3-[5-[(3-methylphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]propanamide (PubChem CID 142257255) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is 3-[5-[(3-methylphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]propanamide.
| Compound Name | 3-[5-[(3-methylphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]propanamide |
|---|---|
| PubChem CID | 142257255 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 3-[5-[(3-methylphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]propanamide |
| SMILES | C=CCn1c(CCC(N)=O)nnc1SCc1cccc(C)c1 |
| InChI | InChI=1S/C16H20N4OS/c1-3-9-20-15(8-7-14(17)21)18-19-16(20)22-11-13-6-4-5-12(2)10-13/h3-6,10H,1,7-9,11H2,2H3,(H2,17,21) |
| InChIKey | MMQOXZGVILWQOQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|