C25H30N4OS — CID 59856003
N-benzyl-5-[5-[(3-methylphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]pentanamide (PubChem CID 59856003) has the molecular formula C25H30N4OS and a molecular weight of 434.61 g/mol. Its IUPAC name is N-benzyl-5-[5-[(3-methylphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]pentanamide.
| Compound Name | N-benzyl-5-[5-[(3-methylphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]pentanamide |
|---|---|
| PubChem CID | 59856003 |
| Molecular Formula | C25H30N4OS |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | N-benzyl-5-[5-[(3-methylphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]pentanamide |
| SMILES | C=CCn1c(CCCCC(=O)NCc2ccccc2)nnc1SCc1cccc(C)c1 |
| InChI | InChI=1S/C25H30N4OS/c1-3-16-29-23(27-28-25(29)31-19-22-13-9-10-20(2)17-22)14-7-8-15-24(30)26-18-21-11-5-4-6-12-21/h3-6,9-13,17H,1,7-8,14-16,18-19H2,2H3,(H,26,30) |
| InChIKey | HBPRRVCAFICCAE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|