C24H30N4OS — CID 59856006
5-[5-[(3-methylphenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]-N-propylpentanamide (PubChem CID 59856006) has the molecular formula C24H30N4OS and a molecular weight of 422.60 g/mol. Its IUPAC name is 5-[5-[(3-methylphenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]-N-propylpentanamide.
| Compound Name | 5-[5-[(3-methylphenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]-N-propylpentanamide |
|---|---|
| PubChem CID | 59856006 |
| Molecular Formula | C24H30N4OS |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 5-[5-[(3-methylphenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]-N-propylpentanamide |
| SMILES | CCCNC(=O)CCCCc1nnc(SCc2cccc(C)c2)n1-c1ccccc1 |
| InChI | InChI=1S/C24H30N4OS/c1-3-16-25-23(29)15-8-7-14-22-26-27-24(28(22)21-12-5-4-6-13-21)30-18-20-11-9-10-19(2)17-20/h4-6,9-13,17H,3,7-8,14-16,18H2,1-2H3,(H,25,29) |
| InChIKey | DSHXIHLBMIZMNJ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|