C23H26Cl2N4OS — CID 59856170
5-[4-(3-chlorophenyl)-5-[(3-chlorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-N-propylpentanamide (PubChem CID 59856170) has the molecular formula C23H26Cl2N4OS and a molecular weight of 477.46 g/mol. Its IUPAC name is 5-[4-(3-chlorophenyl)-5-[(3-chlorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-N-propylpentanamide.
| Compound Name | 5-[4-(3-chlorophenyl)-5-[(3-chlorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-N-propylpentanamide |
|---|---|
| PubChem CID | 59856170 |
| Molecular Formula | C23H26Cl2N4OS |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 5-[4-(3-chlorophenyl)-5-[(3-chlorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-N-propylpentanamide |
| SMILES | CCCNC(=O)CCCCc1nnc(SCc2cccc(Cl)c2)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H26Cl2N4OS/c1-2-13-26-22(30)12-4-3-11-21-27-28-23(29(21)20-10-6-9-19(25)15-20)31-16-17-7-5-8-18(24)14-17/h5-10,14-15H,2-4,11-13,16H2,1H3,(H,26,30) |
| InChIKey | VMEOJHHILSWXHH-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|