C19H16BrCl2N3OS — CID 17305289
3-[(3-bromophenyl)methylsulfanyl]-5-[(2,4-dichlorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 17305289) has the molecular formula C19H16BrCl2N3OS and a molecular weight of 485.23 g/mol. Its IUPAC name is 3-[(3-bromophenyl)methylsulfanyl]-5-[(2,4-dichlorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[(3-bromophenyl)methylsulfanyl]-5-[(2,4-dichlorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 17305289 |
| Molecular Formula | C19H16BrCl2N3OS |
| Molecular Weight | 485.23 g/mol |
| Exact Mass | 482.96 |
| IUPAC Name | 3-[(3-bromophenyl)methylsulfanyl]-5-[(2,4-dichlorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(COc2ccc(Cl)cc2Cl)nnc1SCc1cccc(Br)c1 |
| InChI | InChI=1S/C19H16BrCl2N3OS/c1-2-8-25-18(11-26-17-7-6-15(21)10-16(17)22)23-24-19(25)27-12-13-4-3-5-14(20)9-13/h2-7,9-10H,1,8,11-12H2 |
| InChIKey | SCBQDORWLCUYEH-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.23 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|