C14H13N5S2 — CID 51285691
4-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]thieno[2,3-d]pyrimidine (PubChem CID 51285691) has the molecular formula C14H13N5S2 and a molecular weight of 315.43 g/mol. Its IUPAC name is 4-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]thieno[2,3-d]pyrimidine.
| Compound Name | 4-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 51285691 |
| Molecular Formula | C14H13N5S2 |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 4-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]thieno[2,3-d]pyrimidine |
| SMILES | C=CCn1c(Sc2ncnc3sccc23)nnc1C1CC1 |
| InChI | InChI=1S/C14H13N5S2/c1-2-6-19-11(9-3-4-9)17-18-14(19)21-13-10-5-7-20-12(10)15-8-16-13/h2,5,7-9H,1,3-4,6H2 |
| InChIKey | TYMMTXOQENTMJB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|